CAS 90966-18-0 appears in our catalog under these names: Tienilic Acid Impurity 1(5-Hydroxy Tienilic Acid), 5-Hydroxy Tienilic Acid. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
2-[2,3-dichloro-4-(5-hydroxythiophene-2-carbonyl)phenoxy]acetic acid (CAS 90966-18-0) is a chemical compound with the molecular formula C13H8Cl2O5S and a molecular weight of 347.2 g/mol. IUPAC name: 2-[2,3-dichloro-4-(5-hydroxythiophene-2-carbonyl)phenoxy]acetic acid. InChIKey: WBHMKGJXNGKCIY-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O5S |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | 2-[2,3-dichloro-4-(5-hydroxythiophene-2-carbonyl)phenoxy]acetic acid |
| InChIKey | WBHMKGJXNGKCIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)C2=CC=C(S2)O)Cl)Cl)OCC(=O)O |
Computed by PubChem (NCBI)