CAS 90966-20-4 is the registry number for 2-(2,3-Dichloro-4-((3-hydroxy-2-thienyl)carbonyl)phenoxy)acetic acid. Offered by: TRC. Available pack sizes: 250mg.
2-[2,3-dichloro-4-(3-hydroxythiophene-2-carbonyl)phenoxy]acetic acid (CAS 90966-20-4) is a chemical compound with the molecular formula C13H8Cl2O5S and a molecular weight of 347.2 g/mol. IUPAC name: 2-[2,3-dichloro-4-(3-hydroxythiophene-2-carbonyl)phenoxy]acetic acid. InChIKey: WXUCKPYCDNHGAO-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O5S |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | 2-[2,3-dichloro-4-(3-hydroxythiophene-2-carbonyl)phenoxy]acetic acid |
| InChIKey | WXUCKPYCDNHGAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)C2=C(C=CS2)O)Cl)Cl)OCC(=O)O |
Computed by PubChem (NCBI)