CAS 909725-62-8 appears in our catalog under these names: W146 TFA, W146 (trifluoroacetate salt), W146, W146 (trifluoroacetate salt), 98%, 98%, W146 (TFA), 98.22%. Offered by: TargetMol, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 500ug, 500μg, 25 mg, 5 mg, 50 mg.
[(3R)-3-amino-4-(3-hexylanilino)-4-oxobutyl]phosphonic acid;2,2,2-trifluoroacetic acid (CAS 909725-62-8) is a chemical compound with the molecular formula C18H28F3N2O6P and a molecular weight of 456.4 g/mol. IUPAC name: [(3R)-3-amino-4-(3-hexylanilino)-4-oxobutyl]phosphonic acid;2,2,2-trifluoroacetic acid. InChIKey: JDWCNCPWPLHFEX-XFULWGLBSA-N.
| Molecular formula | C18H28F3N2O6P |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | [(3R)-3-amino-4-(3-hexylanilino)-4-oxobutyl]phosphonic acid;2,2,2-trifluoroacetic acid |
| InChIKey | JDWCNCPWPLHFEX-XFULWGLBSA-N |
| SMILES | CCCCCCC1=CC(=CC=C1)NC(=O)[C@@H](CCP(=O)(O)O)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)