CAS 909725-64-0 appears in our catalog under these names: Phosphonic acid, [(3S)-3-amino-4-[(3-hexylphenyl)amino]-4-oxobutyl]-, mono(trifluoroacetate), 99%, W140 (trifluoroacetate salt), W140 (trifluoroacetate salt), W140 (TFA). Offered by: Chemat Brand, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 500ug, 10mg, 5mg, 500μg, 500 μg.
[(3S)-3-amino-4-(3-hexylanilino)-4-oxobutyl]phosphonic acid;2,2,2-trifluoroacetic acid (CAS 909725-64-0) is a chemical compound with the molecular formula C18H28F3N2O6P and a molecular weight of 456.4 g/mol. IUPAC name: [(3S)-3-amino-4-(3-hexylanilino)-4-oxobutyl]phosphonic acid;2,2,2-trifluoroacetic acid. InChIKey: JDWCNCPWPLHFEX-RSAXXLAASA-N.
| Molecular formula | C18H28F3N2O6P |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | [(3S)-3-amino-4-(3-hexylanilino)-4-oxobutyl]phosphonic acid;2,2,2-trifluoroacetic acid |
| InChIKey | JDWCNCPWPLHFEX-RSAXXLAASA-N |
| SMILES | CCCCCCC1=CC(=CC=C1)NC(=O)[C@H](CCP(=O)(O)O)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)