Products 910405-57-1
CAS 910405-57-1 is the registry number for 2-(3-Fluoro-4-phenoxyphenyl)ethan-1-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3-fluoro-4-phenoxyphenyl)ethanamine (CAS 910405-57-1) is a chemical compound with the molecular formula C14H14FNO and a molecular weight of 231.26 g/mol. IUPAC name: 2-(3-fluoro-4-phenoxyphenyl)ethanamine. InChIKey: OLCFOYXWABUICK-UHFFFAOYSA-N.
| Molecular formula | C14H14FNO |
|---|---|
| Molecular weight | 231.26 g/mol |
| IUPAC name | 2-(3-fluoro-4-phenoxyphenyl)ethanamine |
| InChIKey | OLCFOYXWABUICK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)CCN)F |
Computed by PubChem (NCBI)