Products 91059-67-5
CAS 91059-67-5 is the registry number for methyl 6-nitro-2-oxo-2H-chromene-3-carboxylate, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 5g.
Methyl 6-nitro-2-oxochromene-3-carboxylate (CAS 91059-67-5) is a chemical compound with the molecular formula C11H7NO6 and a molecular weight of 249.18 g/mol. IUPAC name: methyl 6-nitro-2-oxochromene-3-carboxylate. InChIKey: CVKSEQDWXKMNGP-UHFFFAOYSA-N.
| Molecular formula | C11H7NO6 |
|---|---|
| Molecular weight | 249.18 g/mol |
| IUPAC name | methyl 6-nitro-2-oxochromene-3-carboxylate |
| InChIKey | CVKSEQDWXKMNGP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=CC(=C2)[N+](=O)[O-])OC1=O |
Computed by PubChem (NCBI)