CAS 910780-69-7 appears in our catalog under these names: 1-((4-Aminophenyl)imino)tetrahydro-1H-1l6-thiophene 1-oxide, 98%, 1-​((4-​Aminophenyl)​imino)​-thiophene 1-​oxide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-[(1-oxothiolan-1-ylidene)amino]aniline (CAS 910780-69-7) is a chemical compound with the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. IUPAC name: 4-[(1-oxothiolan-1-ylidene)amino]aniline. InChIKey: NCOUMPRRXNKGBV-UHFFFAOYSA-N.
| Molecular formula | C10H14N2OS |
|---|---|
| Molecular weight | 210.30 g/mol |
| IUPAC name | 4-[(1-oxothiolan-1-ylidene)amino]aniline |
| InChIKey | NCOUMPRRXNKGBV-UHFFFAOYSA-N |
| SMILES | C1CCS(=NC2=CC=C(C=C2)N)(=O)C1 |
Computed by PubChem (NCBI)