CAS 91123-65-8 is the registry number for 1-(Chloromethyl)-4-phenyl-3,4-dihydroisoquinoline hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
1-(chloromethyl)-4-phenyl-3,4-dihydroisoquinoline;hydrochloride (CAS 91123-65-8) is a chemical compound with the molecular formula C16H15Cl2N and a molecular weight of 292.2 g/mol. IUPAC name: 1-(chloromethyl)-4-phenyl-3,4-dihydroisoquinoline;hydrochloride. InChIKey: DSJUYVRAFKJQER-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2N |
|---|---|
| Molecular weight | 292.2 g/mol |
| IUPAC name | 1-(chloromethyl)-4-phenyl-3,4-dihydroisoquinoline;hydrochloride |
| InChIKey | DSJUYVRAFKJQER-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC=C2C(=N1)CCl)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)