CAS 918933-19-4 is the registry number for Sertraline Impurity 30. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 918933-19-4) is a chemical compound with the molecular formula C16H15Cl2N and a molecular weight of 292.2 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: SRPXSILJHWNFMK-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2N |
|---|---|
| Molecular weight | 292.2 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | SRPXSILJHWNFMK-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C2C1C3=CC(=C(C=C3)Cl)Cl)N |
Computed by PubChem (NCBI)