Products 911230-59-6
CAS 911230-59-6 is the registry number for N-(4-Bromophenyl)-N-methylbutyramide, 97%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
N-(4-bromophenyl)-N-methylbutanamide (CAS 911230-59-6) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: N-(4-bromophenyl)-N-methylbutanamide. InChIKey: AOXBMPHAPWMYIA-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | N-(4-bromophenyl)-N-methylbutanamide |
| InChIKey | AOXBMPHAPWMYIA-UHFFFAOYSA-N |
| SMILES | CCCC(=O)N(C)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)