CAS 91131-72-5 appears in our catalog under these names: 4-tert-Butyl-3-iodobenzoic acid, 95%, 4–(tert–Butyl)–3–iodobenzoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
4-tert-butyl-3-iodobenzoic acid (CAS 91131-72-5) is a chemical compound with the molecular formula C11H13IO2 and a molecular weight of 304.12 g/mol. IUPAC name: 4-tert-butyl-3-iodobenzoic acid. InChIKey: RKQXGGKRIINFTM-UHFFFAOYSA-N.
| Molecular formula | C11H13IO2 |
|---|---|
| Molecular weight | 304.12 g/mol |
| IUPAC name | 4-tert-butyl-3-iodobenzoic acid |
| InChIKey | RKQXGGKRIINFTM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=C(C=C1)C(=O)O)I |
Computed by PubChem (NCBI)