Products 173406-17-2
CAS 173406-17-2 appears in our catalog under these names: t-Butyl 3-iodobenzoate, 96%, tert–Butyl 3–iodobenzoate, t-Butyl 3-iodobenzoate, tert-Butyl 3-Iodobenzoate, 96%, 96%, tert-Butyl 3-iodobenzoate, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 500mg, 25g.
Tert-butyl 3-iodobenzoate (CAS 173406-17-2) is a chemical compound with the molecular formula C11H13IO2 and a molecular weight of 304.12 g/mol. IUPAC name: tert-butyl 3-iodobenzoate. InChIKey: XZUWLKIILSZGIR-UHFFFAOYSA-N.
| Molecular formula | C11H13IO2 |
|---|---|
| Molecular weight | 304.12 g/mol |
| IUPAC name | tert-butyl 3-iodobenzoate |
| InChIKey | XZUWLKIILSZGIR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=CC=C1)I |
Computed by PubChem (NCBI)