CAS 91132-15-9 appears in our catalog under these names: 2-(4-(Hydroxymethyl)phenyl)-2-methylpropanenitrile, 95%, 2–(4–(Hydroxymethyl)phenyl)–2–methylpropanenitrile, 2-(4-(Hydroxymethyl)phenyl)-2-methylpropanenitrile, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
2-[4-(hydroxymethyl)phenyl]-2-methylpropanenitrile (CAS 91132-15-9) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 2-[4-(hydroxymethyl)phenyl]-2-methylpropanenitrile. InChIKey: MBMXRLPHIQBBHW-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 2-[4-(hydroxymethyl)phenyl]-2-methylpropanenitrile |
| InChIKey | MBMXRLPHIQBBHW-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC=C(C=C1)CO |
Computed by PubChem (NCBI)