CAS 91133-96-9 appears in our catalog under these names: Methyl 3-acetamido-4-methoxybenzoate, 95%, Methyl 3–acetamido–4–methoxybenzoate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Methyl 3-acetamido-4-methoxybenzoate (CAS 91133-96-9) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: methyl 3-acetamido-4-methoxybenzoate. InChIKey: YDDSGIMUUZCBSH-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | methyl 3-acetamido-4-methoxybenzoate |
| InChIKey | YDDSGIMUUZCBSH-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)C(=O)OC)OC |
Computed by PubChem (NCBI)