Products 911809-23-9
CAS 911809-23-9 is the registry number for rac-Harzianolide. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 1mg.
3-[(2E,4E)-hexa-2,4-dienyl]-4-(2-hydroxypropyl)-2H-furan-5-one (CAS 911809-23-9) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 3-[(2E,4E)-hexa-2,4-dienyl]-4-(2-hydroxypropyl)-2H-furan-5-one. InChIKey: KELRJXQJITUJOU-VNKDHWASSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 3-[(2E,4E)-hexa-2,4-dienyl]-4-(2-hydroxypropyl)-2H-furan-5-one |
| InChIKey | KELRJXQJITUJOU-VNKDHWASSA-N |
| SMILES | C/C=C/C=C/CC1=C(C(=O)OC1)CC(C)O |
Computed by PubChem (NCBI)