CAS 91182-78-4 is the registry number for (E)-(4-Chlorophenyl)(2-furyl)methanone oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(NE)-N-[(4-chlorophenyl)-(furan-2-yl)methylidene]hydroxylamine (CAS 91182-78-4) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: (NE)-N-[(4-chlorophenyl)-(furan-2-yl)methylidene]hydroxylamine. InChIKey: RCXDTBNVQYEHKQ-ACCUITESSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | (NE)-N-[(4-chlorophenyl)-(furan-2-yl)methylidene]hydroxylamine |
| InChIKey | RCXDTBNVQYEHKQ-ACCUITESSA-N |
| SMILES | C1=COC(=C1)/C(=N/O)/C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)