CAS 948290-52-6 appears in our catalog under these names: 7-Chloro-8-methylquinoline-3-carboxylic acid, 95%, 7-Chloro-8-methylquinoline-3-carboxylic acid, 95+%, 7-Chloro-8-methylquinoline-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
7-chloro-8-methylquinoline-3-carboxylic acid (CAS 948290-52-6) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: 7-chloro-8-methylquinoline-3-carboxylic acid. InChIKey: ZXPHIRMIGFRUSX-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 7-chloro-8-methylquinoline-3-carboxylic acid |
| InChIKey | ZXPHIRMIGFRUSX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=CC(=CN=C12)C(=O)O)Cl |
Computed by PubChem (NCBI)