CAS 91237-84-2 is the registry number for Boc-Pyr-OtBu. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ditert-butyl (2S)-pyrrolidine-1,2-dicarboxylate (CAS 91237-84-2) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 271.35 g/mol. IUPAC name: ditert-butyl (2S)-pyrrolidine-1,2-dicarboxylate. InChIKey: UMCYLERMBHATJC-JTQLQIEISA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | ditert-butyl (2S)-pyrrolidine-1,2-dicarboxylate |
| InChIKey | UMCYLERMBHATJC-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)