Products 912550-19-7
CAS 912550-19-7 is the registry number for tert-Butyl 6-(bromomethyl)nicotinate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl 6-(bromomethyl)pyridine-3-carboxylate (CAS 912550-19-7) is a chemical compound with the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. IUPAC name: tert-butyl 6-(bromomethyl)pyridine-3-carboxylate. InChIKey: NDFOTTYJJYZQTB-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | tert-butyl 6-(bromomethyl)pyridine-3-carboxylate |
| InChIKey | NDFOTTYJJYZQTB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CN=C(C=C1)CBr |
Computed by PubChem (NCBI)