Products 912838-06-3
CAS 912838-06-3 is the registry number for 4-Azido-n-(2,2,2-trifluoro-ethyl)-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-azido-N-(2,2,2-trifluoroethyl)benzamide (CAS 912838-06-3) is a chemical compound with the molecular formula C9H7F3N4O and a molecular weight of 244.17 g/mol. IUPAC name: 4-azido-N-(2,2,2-trifluoroethyl)benzamide. InChIKey: VLTAACAVQPRSGZ-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N4O |
|---|---|
| Molecular weight | 244.17 g/mol |
| IUPAC name | 4-azido-N-(2,2,2-trifluoroethyl)benzamide |
| InChIKey | VLTAACAVQPRSGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCC(F)(F)F)N=[N+]=[N-] |
Computed by PubChem (NCBI)