Products 930004-85-6
CAS 930004-85-6 appears in our catalog under these names: {1-(5-(trifluoromethyl)pyridin-2-yl)-1H-1,2,3-triazol-4-yl}methanol, 95%, {1-(5-(Trifluoromethyl)pyridin-2-yl)-1H-1,2,3-triazol-4-yl}methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
[1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methanol (CAS 930004-85-6) is a chemical compound with the molecular formula C9H7F3N4O and a molecular weight of 244.17 g/mol. IUPAC name: [1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methanol. InChIKey: WEZZNNGIHSTWIL-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N4O |
|---|---|
| Molecular weight | 244.17 g/mol |
| IUPAC name | [1-[5-(trifluoromethyl)-2-pyridinyl]triazol-4-yl]methanol |
| InChIKey | WEZZNNGIHSTWIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)N2C=C(N=N2)CO |
Computed by PubChem (NCBI)