CAS 91345-76-5 is the registry number for 2-Bromo-1,3-dimethyl-5-propoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
2-bromo-1,3-dimethyl-5-propoxybenzene (CAS 91345-76-5) is a chemical compound with the molecular formula C11H15BrO and a molecular weight of 243.14 g/mol. IUPAC name: 2-bromo-1,3-dimethyl-5-propoxybenzene. InChIKey: UBDBSVZGKAOFEZ-UHFFFAOYSA-N.
| Molecular formula | C11H15BrO |
|---|---|
| Molecular weight | 243.14 g/mol |
| IUPAC name | 2-bromo-1,3-dimethyl-5-propoxybenzene |
| InChIKey | UBDBSVZGKAOFEZ-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC(=C(C(=C1)C)Br)C |
Computed by PubChem (NCBI)