CAS 91371-12-9 appears in our catalog under these names: 4,4'–Dibromo–2,2'–dinitro–1,1'–biphenyl, 4,4'-Dibromo-2,2'-dinitro-1,1'-biphenyl 99%, 4,4'-DIBROMO-2,2'-DINITROBIPHENYL, 97%, 4,4'-Dibromo-2,2'-dinitro-1,1'-biphenyl, 98%, 98%, 4,4'-Dibromo-2,2'-dinitro-1,1'-biphenyl, 98%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 250mg, 100g.
4-bromo-1-(4-bromo-2-nitrophenyl)-2-nitrobenzene (CAS 91371-12-9) is a chemical compound with the molecular formula C12H6Br2N2O4 and a molecular weight of 401.99 g/mol. IUPAC name: 4-bromo-1-(4-bromo-2-nitrophenyl)-2-nitrobenzene. InChIKey: REUCYFQYHWKXPH-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2N2O4 |
|---|---|
| Molecular weight | 401.99 g/mol |
| IUPAC name | 4-bromo-1-(4-bromo-2-nitrophenyl)-2-nitrobenzene |
| InChIKey | REUCYFQYHWKXPH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)[N+](=O)[O-])C2=C(C=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)