CAS 913718-35-1 is the registry number for (4AS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]oxazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4aS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]oxazine (CAS 913718-35-1) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: (4aS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]oxazine. InChIKey: HEDFREPCAHJLOR-MNOVXSKESA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | (4aS,9aR)-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]oxazine |
| InChIKey | HEDFREPCAHJLOR-MNOVXSKESA-N |
| SMILES | C1CO[C@@H]2CC3=CC=CC=C3[C@@H]2N1 |
Computed by PubChem (NCBI)