Products 913723-86-1
CAS 913723-86-1 is the registry number for Ethyl 6-methoxy-2-methyl-3-nitrobenzoate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 6-methoxy-2-methyl-3-nitrobenzoate (CAS 913723-86-1) is a chemical compound with the molecular formula C11H13NO5 and a molecular weight of 239.22 g/mol. IUPAC name: ethyl 6-methoxy-2-methyl-3-nitrobenzoate. InChIKey: QMIYOURSYUGLDQ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO5 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | ethyl 6-methoxy-2-methyl-3-nitrobenzoate |
| InChIKey | QMIYOURSYUGLDQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1C)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)