CAS 913836-05-2 appears in our catalog under these names: 3-[N-(4-Methoxybenzyl)sulfamoyl]phenylboronic acid, 96%, (3-(N-(4-Methoxybenzyl)sulfamoyl)phenyl)boronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 25g.
[3-[(4-methoxyphenyl)methylsulfamoyl]phenyl]boronic acid (CAS 913836-05-2) is a chemical compound with the molecular formula C14H16BNO5S and a molecular weight of 321.2 g/mol. IUPAC name: [3-[(4-methoxyphenyl)methylsulfamoyl]phenyl]boronic acid. InChIKey: BZQHVSULVGIBQT-UHFFFAOYSA-N.
| Molecular formula | C14H16BNO5S |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | [3-[(4-methoxyphenyl)methylsulfamoyl]phenyl]boronic acid |
| InChIKey | BZQHVSULVGIBQT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)S(=O)(=O)NCC2=CC=C(C=C2)OC)(O)O |
Computed by PubChem (NCBI)