Products 957060-91-2

CAS 957060-91-2 appears in our catalog under these names: 4-(N-(4-Methoxybenzyl)sulfamoyl)phenylboronic acid, 98%, (4-(N-(4-Methoxybenzyl)sulfamoyl)phenyl)boronic acid 98%, (4-(N-(4-Methoxybenzyl)sulfamoyl)phenyl)boronic acid, 95%, 95%, (4-(N-(4-Methoxybenzyl)sulfamoyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

[4-[(4-methoxyphenyl)methylsulfamoyl]phenyl]boronic acid (CAS 957060-91-2) is a chemical compound with the molecular formula C14H16BNO5S and a molecular weight of 321.2 g/mol. IUPAC name: [4-[(4-methoxyphenyl)methylsulfamoyl]phenyl]boronic acid. InChIKey: AWIGPKIEHWXBDW-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16BNO5S
Molecular weight321.2 g/mol
IUPAC name[4-[(4-methoxyphenyl)methylsulfamoyl]phenyl]boronic acid
InChIKeyAWIGPKIEHWXBDW-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)S(=O)(=O)NCC2=CC=C(C=C2)OC)(O)O

Computed by PubChem (NCBI)