Products 914208-15-4
CAS 914208-15-4 appears in our catalog under these names: 8-Bromoquinoline-2-carboxylic acid, 8-Bromoquinoline-2-carboxylic acid 98%, 8-Bromoquinoline-2-carboxylic acid, 97%, 97%, 8-Bromoquinoline-2-carboxylic acid, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 250mg, 1g, 100mg.
8-bromoquinoline-2-carboxylic acid (CAS 914208-15-4) is a chemical compound with the molecular formula C10H6BrNO2 and a molecular weight of 252.06 g/mol. IUPAC name: 8-bromoquinoline-2-carboxylic acid. InChIKey: IESLHWGCIUORPV-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2 |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 8-bromoquinoline-2-carboxylic acid |
| InChIKey | IESLHWGCIUORPV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)