CAS 914224-00-3 is the registry number for 6-Bromo-5-nitro-2-pyridinemethanamine. Offered by: TRC. Available pack sizes: 500mg.
(6-bromo-5-nitro-2-pyridinyl)methanamine (CAS 914224-00-3) is a chemical compound with the molecular formula C6H6BrN3O2 and a molecular weight of 232.03 g/mol. IUPAC name: (6-bromo-5-nitro-2-pyridinyl)methanamine. InChIKey: FFHVXUYOKNPOSM-UHFFFAOYSA-N.
| Molecular formula | C6H6BrN3O2 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | (6-bromo-5-nitro-2-pyridinyl)methanamine |
| InChIKey | FFHVXUYOKNPOSM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1CN)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)