CAS 914347-94-7 appears in our catalog under these names: 2-(2-Fluorophenyl)-1,3-thiazole-5-carbaldehyde, 98%, 2-(2-Fluorophenyl)-1,3-thiazole-5-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(2-fluorophenyl)-1,3-thiazole-5-carbaldehyde (CAS 914347-94-7) is a chemical compound with the molecular formula C10H6FNOS and a molecular weight of 207.23 g/mol. IUPAC name: 2-(2-fluorophenyl)-1,3-thiazole-5-carbaldehyde. InChIKey: ZTSHJBXTFGIXSF-UHFFFAOYSA-N.
| Molecular formula | C10H6FNOS |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-1,3-thiazole-5-carbaldehyde |
| InChIKey | ZTSHJBXTFGIXSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=C(S2)C=O)F |
Computed by PubChem (NCBI)