CAS 914348-84-8 is the registry number for 2-(3-Fluorophenyl)thiazole-5-carbaldehyde, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
2-(3-fluorophenyl)-1,3-thiazole-5-carbaldehyde (CAS 914348-84-8) is a chemical compound with the molecular formula C10H6FNOS and a molecular weight of 207.23 g/mol. IUPAC name: 2-(3-fluorophenyl)-1,3-thiazole-5-carbaldehyde. InChIKey: DVWKNTOIBIVPPA-UHFFFAOYSA-N.
| Molecular formula | C10H6FNOS |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-1,3-thiazole-5-carbaldehyde |
| InChIKey | DVWKNTOIBIVPPA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC=C(S2)C=O |
Computed by PubChem (NCBI)