Products 914349-29-4

CAS 914349-29-4 is the registry number for 5-Benzyloxy-3-iodoindole-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 3-iodo-5-phenylmethoxyindole-1-carboxylate (CAS 914349-29-4) is a chemical compound with the molecular formula C20H20INO3 and a molecular weight of 449.3 g/mol. IUPAC name: tert-butyl 3-iodo-5-phenylmethoxyindole-1-carboxylate. InChIKey: XMZGUATULZXTJG-UHFFFAOYSA-N.

Identity
Molecular formulaC20H20INO3
Molecular weight449.3 g/mol
IUPAC nametert-butyl 3-iodo-5-phenylmethoxyindole-1-carboxylate
InChIKeyXMZGUATULZXTJG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C=C(C2=C1C=CC(=C2)OCC3=CC=CC=C3)I

Computed by PubChem (NCBI)