CAS 914349-30-7 appears in our catalog under these names: 6-Benzyloxy-3-iodoindole-1-carboxylic acid tert-butyl ester, 98%, 98%, Tert-butyl 6-(benzyloxy)-3-iodo-1H-indole-1-carboxylate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-iodo-6-phenylmethoxyindole-1-carboxylate (CAS 914349-30-7) is a chemical compound with the molecular formula C20H20INO3 and a molecular weight of 449.3 g/mol. IUPAC name: tert-butyl 3-iodo-6-phenylmethoxyindole-1-carboxylate. InChIKey: WSQPBBGPYIEBLQ-UHFFFAOYSA-N.
| Molecular formula | C20H20INO3 |
|---|---|
| Molecular weight | 449.3 g/mol |
| IUPAC name | tert-butyl 3-iodo-6-phenylmethoxyindole-1-carboxylate |
| InChIKey | WSQPBBGPYIEBLQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=C(C=C2)OCC3=CC=CC=C3)I |
Computed by PubChem (NCBI)