CAS 91442-73-8 appears in our catalog under these names: 3–Acetyladamantane–1–carboxylic acid, 3-Acetyladamantane-1-carboxylic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 0,5g.
3-acetyladamantane-1-carboxylic acid (CAS 91442-73-8) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 3-acetyladamantane-1-carboxylic acid. InChIKey: MKSYFGOQROAZCW-UHFFFAOYSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 3-acetyladamantane-1-carboxylic acid |
| InChIKey | MKSYFGOQROAZCW-UHFFFAOYSA-N |
| SMILES | CC(=O)C12CC3CC(C1)CC(C3)(C2)C(=O)O |
Computed by PubChem (NCBI)