CAS 914457-21-9 is the registry number for 4–bromo–1–(3–chloropyridin–2–yl)–1H–pyrrole–2–carbaldehyde. Offered by: GLPBio. Available pack sizes: 200mg.
4-bromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carbaldehyde (CAS 914457-21-9) is a chemical compound with the molecular formula C10H6BrClN2O and a molecular weight of 285.52 g/mol. IUPAC name: 4-bromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carbaldehyde. InChIKey: HHMFKVWQBWCRHF-UHFFFAOYSA-N.
| Molecular formula | C10H6BrClN2O |
|---|---|
| Molecular weight | 285.52 g/mol |
| IUPAC name | 4-bromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carbaldehyde |
| InChIKey | HHMFKVWQBWCRHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N2C=C(C=C2C=O)Br)Cl |
Computed by PubChem (NCBI)