Products 914626-62-3

CAS 914626-62-3 is the registry number for Bendamustine Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(5-amino-1-methylbenzimidazol-2-yl)butanoic acid (CAS 914626-62-3) is a chemical compound with the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. IUPAC name: 4-(5-amino-1-methylbenzimidazol-2-yl)butanoic acid. InChIKey: OLZMGZSRWXDGRO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15N3O2
Molecular weight233.27 g/mol
IUPAC name4-(5-amino-1-methylbenzimidazol-2-yl)butanoic acid
InChIKeyOLZMGZSRWXDGRO-UHFFFAOYSA-N
SMILESCN1C2=C(C=C(C=C2)N)N=C1CCCC(=O)O

Computed by PubChem (NCBI)