CAS 91493-29-7 is the registry number for Dibenzofuran-3-ylamine hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g.
Dibenzofuran-3-amine;hydrochloride (CAS 91493-29-7) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: dibenzofuran-3-amine;hydrochloride. InChIKey: IVINWYJZLOTUFA-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | dibenzofuran-3-amine;hydrochloride |
| InChIKey | IVINWYJZLOTUFA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=C(C=C3)N.Cl |
Computed by PubChem (NCBI)