CAS 914943-91-2 appears in our catalog under these names: tert–Butyl 3–ethynylbenzoate, tert-Butyl 3-ethynylbenzoate 95%, tert-Butyl 3-ethynylbenzoate, 98%, 98%, TERT-BUTYL 3-ETHYNYLBENZOATE, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
Tert-butyl 3-ethynylbenzoate (CAS 914943-91-2) is a chemical compound with the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl 3-ethynylbenzoate. InChIKey: SSDAUMHJIKPITN-UHFFFAOYSA-N.
| Molecular formula | C13H14O2 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl 3-ethynylbenzoate |
| InChIKey | SSDAUMHJIKPITN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC(=C1)C#C |
Computed by PubChem (NCBI)