Products 914953-65-4
CAS 914953-65-4 is the registry number for Pentacyclo(7.3.1.1{4,12}.0{2,7}.0{6,11})tetradecane-4,9-diamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-diamine;dihydrochloride (CAS 914953-65-4) is a chemical compound with the molecular formula C14H24Cl2N2 and a molecular weight of 291.3 g/mol. IUPAC name: pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-diamine;dihydrochloride. InChIKey: PSILOCQYEWAPOK-UHFFFAOYSA-N.
| Molecular formula | C14H24Cl2N2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-4,9-diamine;dihydrochloride |
| InChIKey | PSILOCQYEWAPOK-UHFFFAOYSA-N |
| SMILES | C1C2C3CC4(CC2C5CC1(CC3C5C4)N)N.Cl.Cl |
Computed by PubChem (NCBI)