CAS 91527-90-1 is the registry number for (3-Methyl-4-nitrophenyl)hydrazine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
(3-methyl-4-nitrophenyl)hydrazine (CAS 91527-90-1) is a chemical compound with the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. IUPAC name: (3-methyl-4-nitrophenyl)hydrazine. InChIKey: LJZQXGVKYRUBFR-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O2 |
|---|---|
| Molecular weight | 167.17 g/mol |
| IUPAC name | (3-methyl-4-nitrophenyl)hydrazine |
| InChIKey | LJZQXGVKYRUBFR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)