CAS 91591-66-1 appears in our catalog under these names: Opicapone Impurity 1, Opicapone Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-2-methoxy-4,6-dimethylpyridine-3-carbonitrile (CAS 91591-66-1) is a chemical compound with the molecular formula C9H9ClN2O and a molecular weight of 196.63 g/mol. IUPAC name: 5-chloro-2-methoxy-4,6-dimethylpyridine-3-carbonitrile. InChIKey: BIOUFGBVFKXAMD-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 5-chloro-2-methoxy-4,6-dimethylpyridine-3-carbonitrile |
| InChIKey | BIOUFGBVFKXAMD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1Cl)C)OC)C#N |
Computed by PubChem (NCBI)