Products 91591-66-1

CAS 91591-66-1 appears in our catalog under these names: Opicapone Impurity 1, Opicapone Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-chloro-2-methoxy-4,6-dimethylpyridine-3-carbonitrile (CAS 91591-66-1) is a chemical compound with the molecular formula C9H9ClN2O and a molecular weight of 196.63 g/mol. IUPAC name: 5-chloro-2-methoxy-4,6-dimethylpyridine-3-carbonitrile. InChIKey: BIOUFGBVFKXAMD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClN2O
Molecular weight196.63 g/mol
IUPAC name5-chloro-2-methoxy-4,6-dimethylpyridine-3-carbonitrile
InChIKeyBIOUFGBVFKXAMD-UHFFFAOYSA-N
SMILESCC1=C(C(=NC(=C1Cl)C)OC)C#N

Computed by PubChem (NCBI)