Products 916179-45-8
CAS 916179-45-8 is the registry number for Tau protein aggregation-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(5-bromo-1H-indol-3-yl)-1H-indole-5-carboxylic acid (CAS 916179-45-8) is a chemical compound with the molecular formula C17H11BrN2O2 and a molecular weight of 355.2 g/mol. IUPAC name: 3-(5-bromo-1H-indol-3-yl)-1H-indole-5-carboxylic acid. InChIKey: UUSPZIQJACESNB-UHFFFAOYSA-N.
| Molecular formula | C17H11BrN2O2 |
|---|---|
| Molecular weight | 355.2 g/mol |
| IUPAC name | 3-(5-bromo-1H-indol-3-yl)-1H-indole-5-carboxylic acid |
| InChIKey | UUSPZIQJACESNB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C(=CN2)C3=CNC4=C3C=C(C=C4)Br |
Computed by PubChem (NCBI)
Synonyms:
Tau protein aggregation-IN-1, orb1944379