CAS 91639-96-2 is the registry number for 2-(4-(tert-Butyl)phenyl)-2-hydroxyacetonitrile. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(4-tert-butylphenyl)-2-hydroxyacetonitrile (CAS 91639-96-2) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-2-hydroxyacetonitrile. InChIKey: IDVNRVASEIMNBY-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-2-hydroxyacetonitrile |
| InChIKey | IDVNRVASEIMNBY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(C#N)O |
Computed by PubChem (NCBI)