CAS 916850-37-8 is the registry number for 1-Butyl-3-methyl-1H-imidazol-3-ium methyl carbonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-butyl-3-methylimidazol-3-ium;methyl carbonate (CAS 916850-37-8) is a chemical compound with the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. IUPAC name: 1-butyl-3-methylimidazol-3-ium;methyl carbonate. InChIKey: LMNFQNYYIIOYFR-UHFFFAOYSA-M.
| Molecular formula | C10H18N2O3 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 1-butyl-3-methylimidazol-3-ium;methyl carbonate |
| InChIKey | LMNFQNYYIIOYFR-UHFFFAOYSA-M |
| SMILES | CCCCN1C=C[N+](=C1)C.COC(=O)[O-] |
Computed by PubChem (NCBI)