Products 916890-10-3
CAS 916890-10-3 is the registry number for Puquitinib. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-N-cyclopropyl-2-N-quinolin-6-yl-7H-purine-2,6-diamine (CAS 916890-10-3) is a chemical compound with the molecular formula C17H15N7 and a molecular weight of 317.3 g/mol. IUPAC name: 6-N-cyclopropyl-2-N-quinolin-6-yl-7H-purine-2,6-diamine. InChIKey: QUTFBURLXCODBH-UHFFFAOYSA-N.
| Molecular formula | C17H15N7 |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | 6-N-cyclopropyl-2-N-quinolin-6-yl-7H-purine-2,6-diamine |
| InChIKey | QUTFBURLXCODBH-UHFFFAOYSA-N |
| SMILES | C1CC1NC2=NC(=NC3=C2NC=N3)NC4=CC5=C(C=C4)N=CC=C5 |
Computed by PubChem (NCBI)