Products 91748-09-3
CAS 91748-09-3 is the registry number for 2-ethoxy-1,3-dimethyl-5-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-ethoxy-1,3-dimethyl-5-nitrobenzene (CAS 91748-09-3) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 2-ethoxy-1,3-dimethyl-5-nitrobenzene. InChIKey: SZCGXJFNMIHJAF-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 2-ethoxy-1,3-dimethyl-5-nitrobenzene |
| InChIKey | SZCGXJFNMIHJAF-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1C)[N+](=O)[O-])C |
Computed by PubChem (NCBI)