Products 91764-23-7
CAS 91764-23-7 is the registry number for 2-Isopropyl-1,3-dimethoxy-5-methylbenzene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-dimethoxy-5-methyl-2-propan-2-ylbenzene (CAS 91764-23-7) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: 1,3-dimethoxy-5-methyl-2-propan-2-ylbenzene. InChIKey: AHQDITQEFNYPIX-UHFFFAOYSA-N.
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | 1,3-dimethoxy-5-methyl-2-propan-2-ylbenzene |
| InChIKey | AHQDITQEFNYPIX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)OC)C(C)C)OC |
Computed by PubChem (NCBI)