Products 91817-41-3
CAS 91817-41-3 is the registry number for 9(R)–Hexahydrocannabinol methyl ether. Offered by: GLPBio. Available pack sizes: 1mg.
(6aR,9R,10aR)-1-methoxy-6,6,9-trimethyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene (CAS 91817-41-3) is a chemical compound with the molecular formula C22H34O2 and a molecular weight of 330.5 g/mol. IUPAC name: (6aR,9R,10aR)-1-methoxy-6,6,9-trimethyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene. InChIKey: FJNYRBFCDFVKTA-KBAYOESNSA-N.
| Molecular formula | C22H34O2 |
|---|---|
| Molecular weight | 330.5 g/mol |
| IUPAC name | (6aR,9R,10aR)-1-methoxy-6,6,9-trimethyl-3-pentyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene |
| InChIKey | FJNYRBFCDFVKTA-KBAYOESNSA-N |
| SMILES | CCCCCC1=CC2=C([C@@H]3C[C@@H](CC[C@H]3C(O2)(C)C)C)C(=C1)OC |
Computed by PubChem (NCBI)
Synonyms:
9(R)-Hexahydrocannabinol methyl ether