Products 918306-38-4

CAS 918306-38-4 is the registry number for Nefopam Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[2-hydroxyethyl(methyl)carbamoyl]benzoic acid (CAS 918306-38-4) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 2-[2-hydroxyethyl(methyl)carbamoyl]benzoic acid. InChIKey: BQOZMFNFPKVRLB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO4
Molecular weight223.22 g/mol
IUPAC name2-[2-hydroxyethyl(methyl)carbamoyl]benzoic acid
InChIKeyBQOZMFNFPKVRLB-UHFFFAOYSA-N
SMILESCN(CCO)C(=O)C1=CC=CC=C1C(=O)O

Computed by PubChem (NCBI)