Products 91908-71-3

CAS 91908-71-3 is the registry number for Carbidopa Impurity 6(Carbidopa EP Impurity F). Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Ethyl 3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoate (CAS 91908-71-3) is a chemical compound with the molecular formula C12H18N2O4 and a molecular weight of 254.28 g/mol. IUPAC name: ethyl 3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoate. InChIKey: IVYOMTNVXXPNCD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18N2O4
Molecular weight254.28 g/mol
IUPAC nameethyl 3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoate
InChIKeyIVYOMTNVXXPNCD-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)(CC1=CC(=C(C=C1)O)O)NN

Computed by PubChem (NCBI)